C18H20BrF4N5O2 — CID 155361804
[(2-bromo-3-fluoro-4-pyridinyl)amino]-[(11R)-11,14,14-trifluoro-11-(hydroxymethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanol (PubChem CID 155361804) has the molecular formula C18H20BrF4N5O2 and a molecular weight of 494.29 g/mol. Its IUPAC name is [(2-bromo-3-fluoro-4-pyridinyl)amino]-[(11R)-11,14,14-trifluoro-11-(hydroxymethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanol.
| Compound Name | [(2-bromo-3-fluoro-4-pyridinyl)amino]-[(11R)-11,14,14-trifluoro-11-(hydroxymethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanol |
|---|---|
| PubChem CID | 155361804 |
| Molecular Formula | C18H20BrF4N5O2 |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | [(2-bromo-3-fluoro-4-pyridinyl)amino]-[(11R)-11,14,14-trifluoro-11-(hydroxymethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanol |
| SMILES | OC[C@@]1(F)CCC(F)(F)c2c3c(nn2C1)CCN(C(O)Nc1ccnc(Br)c1F)C3 |
| InChI | InChI=1S/C18H20BrF4N5O2/c19-15-13(20)12(1-5-24-15)25-16(30)27-6-2-11-10(7-27)14-18(22,23)4-3-17(21,9-29)8-28(14)26-11/h1,5,16,29-30H,2-4,6-9H2,(H,24,25)/t16?,17-/m1/s1 |
| InChIKey | XGLPZRHBWUALTF-ZYMOGRSISA-N |
| XLogP | 2.51 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|