C20H22BrF3N6O4 — CID 162461048
N-(2-bromo-3-fluoro-4-pyridinyl)-11-(2,2-difluoroethoxymethyl)-11,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 162461048) has the molecular formula C20H22BrF3N6O4 and a molecular weight of 547.33 g/mol. Its IUPAC name is N-(2-bromo-3-fluoro-4-pyridinyl)-11-(2,2-difluoroethoxymethyl)-11,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | N-(2-bromo-3-fluoro-4-pyridinyl)-11-(2,2-difluoroethoxymethyl)-11,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 162461048 |
| Molecular Formula | C20H22BrF3N6O4 |
| Molecular Weight | 547.33 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | N-(2-bromo-3-fluoro-4-pyridinyl)-11-(2,2-difluoroethoxymethyl)-11,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | CN1OC(C)(COCC(F)F)Cn2nc3c(c2C1=O)CN(C(=O)Nc1ccnc(Br)c1F)CC3 |
| InChI | InChI=1S/C20H22BrF3N6O4/c1-20(10-33-8-14(22)23)9-30-16(18(31)28(2)34-20)11-7-29(6-4-12(11)27-30)19(32)26-13-3-5-25-17(21)15(13)24/h3,5,14H,4,6-10H2,1-2H3,(H,25,26,32) |
| InChIKey | OBYZWZJVCAQUIQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|