C18H21BrF3N5O2 — CID 167672179
(12S)-N-(2-bromo-3-fluoro-4-pyridinyl)-14,14-difluoro-12-hydroxy-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane (PubChem CID 167672179) has the molecular formula C18H21BrF3N5O2 and a molecular weight of 476.30 g/mol. Its IUPAC name is (12S)-N-(2-bromo-3-fluoro-4-pyridinyl)-14,14-difluoro-12-hydroxy-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane.
| Compound Name | (12S)-N-(2-bromo-3-fluoro-4-pyridinyl)-14,14-difluoro-12-hydroxy-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane |
|---|---|
| PubChem CID | 167672179 |
| Molecular Formula | C18H21BrF3N5O2 |
| Molecular Weight | 476.30 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | (12S)-N-(2-bromo-3-fluoro-4-pyridinyl)-14,14-difluoro-12-hydroxy-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane |
| SMILES | C.O=C(Nc1ccnc(Br)c1F)N1CCc2nn3c(c2C1)C(F)(F)C[C@@H](O)CC3 |
| InChI | InChI=1S/C17H17BrF3N5O2.CH4/c18-15-13(19)12(1-4-22-15)23-16(28)25-5-3-11-10(8-25)14-17(20,21)7-9(27)2-6-26(14)24-11;/h1,4,9,27H,2-3,5-8H2,(H,22,23,28);1H4/t9-;/m0./s1 |
| InChIKey | UGYGVZUMISLKIE-FVGYRXGTSA-N |
| XLogP | 3.65 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|