C20H21F5N4O2 — CID 163201693
(5R,12S)-N-[3-(difluoromethyl)-2-fluorophenyl]-14,14-difluoro-12-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 163201693) has the molecular formula C20H21F5N4O2 and a molecular weight of 444.40 g/mol. Its IUPAC name is (5R,12S)-N-[3-(difluoromethyl)-2-fluorophenyl]-14,14-difluoro-12-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R,12S)-N-[3-(difluoromethyl)-2-fluorophenyl]-14,14-difluoro-12-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 163201693 |
| Molecular Formula | C20H21F5N4O2 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (5R,12S)-N-[3-(difluoromethyl)-2-fluorophenyl]-14,14-difluoro-12-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)Nc1cccc(C(F)F)c1F)C(F)(F)C[C@@H](O)CC3 |
| InChI | InChI=1S/C20H21F5N4O2/c1-10-7-15-13(17-20(24,25)8-11(30)5-6-29(17)27-15)9-28(10)19(31)26-14-4-2-3-12(16(14)21)18(22)23/h2-4,10-11,18,30H,5-9H2,1H3,(H,26,31)/t10-,11+/m1/s1 |
| InChIKey | ADKFSKXNFTXFSB-MNOVXSKESA-N |
| XLogP | 4.18 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |