C18H19BrF3N5O2 — CID 159198386
N-(5-bromo-2,4-difluorophenyl)-11-fluoro-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane (PubChem CID 159198386) has the molecular formula C18H19BrF3N5O2 and a molecular weight of 474.28 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-11-fluoro-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-11-fluoro-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane |
|---|---|
| PubChem CID | 159198386 |
| Molecular Formula | C18H19BrF3N5O2 |
| Molecular Weight | 474.28 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-11-fluoro-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane |
| SMILES | C.O=C1NCC(F)Cn2nc3c(c21)CN(C(=O)Nc1cc(Br)c(F)cc1F)CC3 |
| InChI | InChI=1S/C17H15BrF3N5O2.CH4/c18-10-3-14(12(21)4-11(10)20)23-17(28)25-2-1-13-9(7-25)15-16(27)22-5-8(19)6-26(15)24-13;/h3-4,8H,1-2,5-7H2,(H,22,27)(H,23,28);1H4 |
| InChIKey | KOYPFRISMQUTPI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|