C18H18BrF2N5O3 — CID 145434692
(5R)-N-(5-bromo-2,4-difluorophenyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 145434692) has the molecular formula C18H18BrF2N5O3 and a molecular weight of 470.27 g/mol. Its IUPAC name is (5R)-N-(5-bromo-2,4-difluorophenyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R)-N-(5-bromo-2,4-difluorophenyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 145434692 |
| Molecular Formula | C18H18BrF2N5O3 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | (5R)-N-(5-bromo-2,4-difluorophenyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)Nc1cc(Br)c(F)cc1F)C(=O)N(C)OCC3 |
| InChI | InChI=1S/C18H18BrF2N5O3/c1-9-5-14-10(16-17(27)24(2)29-4-3-26(16)23-14)8-25(9)18(28)22-15-6-11(19)12(20)7-13(15)21/h6-7,9H,3-5,8H2,1-2H3,(H,22,28)/t9-/m1/s1 |
| InChIKey | RMCDPYPJZIKVFJ-SECBINFHSA-N |
| XLogP | 2.92 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|