C19H20BrF2N5O4 — CID 146657476
(5R,11R)-N-(3-bromo-2,4-difluorophenyl)-11-(hydroxymethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 146657476) has the molecular formula C19H20BrF2N5O4 and a molecular weight of 500.30 g/mol. Its IUPAC name is (5R,11R)-N-(3-bromo-2,4-difluorophenyl)-11-(hydroxymethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R,11R)-N-(3-bromo-2,4-difluorophenyl)-11-(hydroxymethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 146657476 |
| Molecular Formula | C19H20BrF2N5O4 |
| Molecular Weight | 500.30 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | (5R,11R)-N-(3-bromo-2,4-difluorophenyl)-11-(hydroxymethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)Nc1ccc(F)c(Br)c1F)C(=O)N(C)O[C@@H](CO)C3 |
| InChI | InChI=1S/C19H20BrF2N5O4/c1-9-5-14-11(17-18(29)25(2)31-10(8-28)6-27(17)24-14)7-26(9)19(30)23-13-4-3-12(21)15(20)16(13)22/h3-4,9-10,28H,5-8H2,1-2H3,(H,23,30)/t9-,10-/m1/s1 |
| InChIKey | QJWNKDDXUKEUKI-NXEZZACHSA-N |
| XLogP | 2.28 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|