C20H21ClF2N6O4 — CID 145434601
4-N-(3-chloro-2,4-difluorophenyl)-11-N,5,13-trimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxamide (PubChem CID 145434601) has the molecular formula C20H21ClF2N6O4 and a molecular weight of 482.88 g/mol. Its IUPAC name is 4-N-(3-chloro-2,4-difluorophenyl)-11-N,5,13-trimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxamide.
| Compound Name | 4-N-(3-chloro-2,4-difluorophenyl)-11-N,5,13-trimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxamide |
|---|---|
| PubChem CID | 145434601 |
| Molecular Formula | C20H21ClF2N6O4 |
| Molecular Weight | 482.88 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 4-N-(3-chloro-2,4-difluorophenyl)-11-N,5,13-trimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxamide |
| SMILES | CNC(=O)C1Cn2nc3c(c2C(=O)N(C)O1)CN(C(=O)Nc1ccc(F)c(Cl)c1F)C(C)C3 |
| InChI | InChI=1S/C20H21ClF2N6O4/c1-9-6-13-10(7-28(9)20(32)25-12-5-4-11(22)15(21)16(12)23)17-19(31)27(3)33-14(18(30)24-2)8-29(17)26-13/h4-5,9,14H,6-8H2,1-3H3,(H,24,30)(H,25,32) |
| InChIKey | FBPKSVHDHCDEDB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.88 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|