C20H21ClF4N6O3 — CID 145434714
(11R)-N-(3-chloro-2,4-difluorophenyl)-11-[(2,2-difluoroethylamino)methyl]-13-methyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 145434714) has the molecular formula C20H21ClF4N6O3 and a molecular weight of 504.87 g/mol. Its IUPAC name is (11R)-N-(3-chloro-2,4-difluorophenyl)-11-[(2,2-difluoroethylamino)methyl]-13-methyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (11R)-N-(3-chloro-2,4-difluorophenyl)-11-[(2,2-difluoroethylamino)methyl]-13-methyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 145434714 |
| Molecular Formula | C20H21ClF4N6O3 |
| Molecular Weight | 504.87 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | (11R)-N-(3-chloro-2,4-difluorophenyl)-11-[(2,2-difluoroethylamino)methyl]-13-methyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | CN1O[C@H](CNCC(F)F)Cn2nc3c(c2C1=O)CN(C(=O)Nc1ccc(F)c(Cl)c1F)CC3 |
| InChI | InChI=1S/C20H21ClF4N6O3/c1-29-19(32)18-11-9-30(20(33)27-14-3-2-12(22)16(21)17(14)25)5-4-13(11)28-31(18)8-10(34-29)6-26-7-15(23)24/h2-3,10,15,26H,4-9H2,1H3,(H,27,33)/t10-/m1/s1 |
| InChIKey | ZYPYPNLZXLWGFB-SNVBAGLBSA-N |
| XLogP | 2.65 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.87 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|