C20H22BrF2N5O3 — CID 145434985
(5R,11S)-N-(3-bromo-2,4-difluorophenyl)-11-(hydroxymethyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 145434985) has the molecular formula C20H22BrF2N5O3 and a molecular weight of 498.33 g/mol. Its IUPAC name is (5R,11S)-N-(3-bromo-2,4-difluorophenyl)-11-(hydroxymethyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R,11S)-N-(3-bromo-2,4-difluorophenyl)-11-(hydroxymethyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 145434985 |
| Molecular Formula | C20H22BrF2N5O3 |
| Molecular Weight | 498.33 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | (5R,11S)-N-(3-bromo-2,4-difluorophenyl)-11-(hydroxymethyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)Nc1ccc(F)c(Br)c1F)C(=O)N(C)C[C@H](CO)C3 |
| InChI | InChI=1S/C20H22BrF2N5O3/c1-10-5-15-12(18-19(30)26(2)6-11(9-29)7-28(18)25-15)8-27(10)20(31)24-14-4-3-13(22)16(21)17(14)23/h3-4,10-11,29H,5-9H2,1-2H3,(H,24,31)/t10-,11+/m1/s1 |
| InChIKey | BLZMNTMPZSZTPJ-MNOVXSKESA-N |
| XLogP | 2.60 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|