C18H18BrF4N5O — CID 155352805
N-(2-bromo-3-fluoro-4-pyridinyl)-14,14-difluoro-12-(fluoromethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 155352805) has the molecular formula C18H18BrF4N5O and a molecular weight of 476.27 g/mol. Its IUPAC name is N-(2-bromo-3-fluoro-4-pyridinyl)-14,14-difluoro-12-(fluoromethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | N-(2-bromo-3-fluoro-4-pyridinyl)-14,14-difluoro-12-(fluoromethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 155352805 |
| Molecular Formula | C18H18BrF4N5O |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N-(2-bromo-3-fluoro-4-pyridinyl)-14,14-difluoro-12-(fluoromethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | O=C(Nc1ccnc(Br)c1F)N1CCc2nn3c(c2C1)C(F)(F)CC(CF)CC3 |
| InChI | InChI=1S/C18H18BrF4N5O/c19-16-14(21)13(1-4-24-16)25-17(29)27-5-3-12-11(9-27)15-18(22,23)7-10(8-20)2-6-28(15)26-12/h1,4,10H,2-3,5-9H2,(H,24,25,29) |
| InChIKey | NKYQGJKWLOWMIO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|