C22H23F4N7O4 — CID 145434526
N-(3-cyano-2,4-difluorophenyl)-13-methyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;N-(2,2-difluoroethyl)-N-methylformamide (PubChem CID 145434526) has the molecular formula C22H23F4N7O4 and a molecular weight of 525.46 g/mol. Its IUPAC name is N-(3-cyano-2,4-difluorophenyl)-13-methyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;N-(2,2-difluoroethyl)-N-methylformamide.
| Compound Name | N-(3-cyano-2,4-difluorophenyl)-13-methyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;N-(2,2-difluoroethyl)-N-methylformamide |
|---|---|
| PubChem CID | 145434526 |
| Molecular Formula | C22H23F4N7O4 |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | N-(3-cyano-2,4-difluorophenyl)-13-methyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;N-(2,2-difluoroethyl)-N-methylformamide |
| SMILES | CN(C=O)CC(F)F.CN1OCCn2nc3c(c2C1=O)CN(C(=O)Nc1ccc(F)c(C#N)c1F)CC3 |
| InChI | InChI=1S/C18H16F2N6O3.C4H7F2NO/c1-24-17(27)16-11-9-25(5-4-13(11)23-26(16)6-7-29-24)18(28)22-14-3-2-12(19)10(8-21)15(14)20;1-7(3-8)2-4(5)6/h2-3H,4-7,9H2,1H3,(H,22,28);3-4H,2H2,1H3 |
| InChIKey | IVXOBEAWNMZLPQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|