C21H21Cl2N7O2 — CID 155342947
(11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155342947) has the molecular formula C21H21Cl2N7O2 and a molecular weight of 474.35 g/mol. Its IUPAC name is (11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155342947 |
| Molecular Formula | C21H21Cl2N7O2 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(=O)N([C@@H](C)c1ncn[nH]1)CC3 |
| InChI | InChI=1S/C21H21Cl2N7O2/c1-11-7-17-14(9-29(11)20(31)13-3-4-15(22)16(23)8-13)18-21(32)28(5-6-30(18)27-17)12(2)19-24-10-25-26-19/h3-4,8,10-12H,5-7,9H2,1-2H3,(H,24,25,26)/t11-,12+/m1/s1 |
| InChIKey | NCZBIMXYIJIEAS-NEPJUHHUSA-N |
| XLogP | 3.11 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |