C27H28Cl2N4O4 — CID 155366485
(11R)-12-(3,4-dichlorobenzoyl)-4-[1-(3,4-dimethoxyphenyl)ethyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155366485) has the molecular formula C27H28Cl2N4O4 and a molecular weight of 543.45 g/mol. Its IUPAC name is (11R)-12-(3,4-dichlorobenzoyl)-4-[1-(3,4-dimethoxyphenyl)ethyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-12-(3,4-dichlorobenzoyl)-4-[1-(3,4-dimethoxyphenyl)ethyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155366485 |
| Molecular Formula | C27H28Cl2N4O4 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | (11R)-12-(3,4-dichlorobenzoyl)-4-[1-(3,4-dimethoxyphenyl)ethyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | COc1ccc(C(C)N2CCn3nc4c(c3C2=O)CN(C(=O)c2ccc(Cl)c(Cl)c2)[C@H](C)C4)cc1OC |
| InChI | InChI=1S/C27H28Cl2N4O4/c1-15-11-22-19(14-32(15)26(34)18-5-7-20(28)21(29)12-18)25-27(35)31(9-10-33(25)30-22)16(2)17-6-8-23(36-3)24(13-17)37-4/h5-8,12-13,15-16H,9-11,14H2,1-4H3/t15-,16?/m1/s1 |
| InChIKey | GQWCEZTVOOPJQG-AAFJCEBUSA-N |
| XLogP | 5.01 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |