C24H21Cl2F2N5O3 — CID 155366440
(11R)-12-(3,4-dichlorobenzoyl)-4-[[5-(difluoromethoxy)-2-pyridinyl]methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155366440) has the molecular formula C24H21Cl2F2N5O3 and a molecular weight of 536.37 g/mol. Its IUPAC name is (11R)-12-(3,4-dichlorobenzoyl)-4-[[5-(difluoromethoxy)-2-pyridinyl]methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-12-(3,4-dichlorobenzoyl)-4-[[5-(difluoromethoxy)-2-pyridinyl]methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155366440 |
| Molecular Formula | C24H21Cl2F2N5O3 |
| Molecular Weight | 536.37 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | (11R)-12-(3,4-dichlorobenzoyl)-4-[[5-(difluoromethoxy)-2-pyridinyl]methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(=O)N(Cc1ccc(OC(F)F)cn1)CC3 |
| InChI | InChI=1S/C24H21Cl2F2N5O3/c1-13-8-20-17(12-32(13)22(34)14-2-5-18(25)19(26)9-14)21-23(35)31(6-7-33(21)30-20)11-15-3-4-16(10-29-15)36-24(27)28/h2-5,9-10,13,24H,6-8,11-12H2,1H3/t13-/m1/s1 |
| InChIKey | DYABLPAPRKDFNO-CYBMUJFWSA-N |
| XLogP | 4.43 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |