C26H26Cl2N4O3 — CID 155342591
(5R)-4-(3,4-dichlorobenzoyl)-13-[(4-methoxyphenyl)methyl]-5-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one (PubChem CID 155342591) has the molecular formula C26H26Cl2N4O3 and a molecular weight of 513.43 g/mol. Its IUPAC name is (5R)-4-(3,4-dichlorobenzoyl)-13-[(4-methoxyphenyl)methyl]-5-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one.
| Compound Name | (5R)-4-(3,4-dichlorobenzoyl)-13-[(4-methoxyphenyl)methyl]-5-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one |
|---|---|
| PubChem CID | 155342591 |
| Molecular Formula | C26H26Cl2N4O3 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | (5R)-4-(3,4-dichlorobenzoyl)-13-[(4-methoxyphenyl)methyl]-5-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one |
| SMILES | COc1ccc(CN2CCCn3nc4c(c3C2=O)CN(C(=O)c2ccc(Cl)c(Cl)c2)[C@H](C)C4)cc1 |
| InChI | InChI=1S/C26H26Cl2N4O3/c1-16-12-23-20(15-31(16)25(33)18-6-9-21(27)22(28)13-18)24-26(34)30(10-3-11-32(24)29-23)14-17-4-7-19(35-2)8-5-17/h4-9,13,16H,3,10-12,14-15H2,1-2H3/t16-/m1/s1 |
| InChIKey | DLUWUBVSFYXXJX-MRXNPFEDSA-N |
| XLogP | 4.83 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |