C24H22Cl2N4O3 — CID 155342725
12-(3,4-dichlorobenzoyl)-4-[(4-methoxyphenyl)methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155342725) has the molecular formula C24H22Cl2N4O3 and a molecular weight of 485.37 g/mol. Its IUPAC name is 12-(3,4-dichlorobenzoyl)-4-[(4-methoxyphenyl)methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | 12-(3,4-dichlorobenzoyl)-4-[(4-methoxyphenyl)methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155342725 |
| Molecular Formula | C24H22Cl2N4O3 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 12-(3,4-dichlorobenzoyl)-4-[(4-methoxyphenyl)methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | COc1ccc(CN2CCn3nc4c(c3C2=O)CN(C(=O)c2ccc(Cl)c(Cl)c2)CC4)cc1 |
| InChI | InChI=1S/C24H22Cl2N4O3/c1-33-17-5-2-15(3-6-17)13-29-10-11-30-22(24(29)32)18-14-28(9-8-21(18)27-30)23(31)16-4-7-19(25)20(26)12-16/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | OJLCLXZOWAPYRX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |