C22H19Cl2N5O2 — CID 166018743
12-(3,4-dichlorobenzoyl)-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 166018743) has the molecular formula C22H19Cl2N5O2 and a molecular weight of 456.33 g/mol. Its IUPAC name is 12-(3,4-dichlorobenzoyl)-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | 12-(3,4-dichlorobenzoyl)-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 166018743 |
| Molecular Formula | C22H19Cl2N5O2 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 12-(3,4-dichlorobenzoyl)-4-(pyridin-2-ylmethyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCc2nn3c(c2C1)C(=O)N(Cc1ccccn1)CC3 |
| InChI | InChI=1S/C22H19Cl2N5O2/c23-17-5-4-14(11-18(17)24)21(30)27-8-6-19-16(13-27)20-22(31)28(9-10-29(20)26-19)12-15-3-1-2-7-25-15/h1-5,7,11H,6,8-10,12-13H2 |
| InChIKey | YAJGOUQYSHYXIE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |