C24H20Cl2N4O2 — CID 155366527
12-(3,4-dichlorobenzoyl)-4-(1-phenylethenyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155366527) has the molecular formula C24H20Cl2N4O2 and a molecular weight of 467.36 g/mol. Its IUPAC name is 12-(3,4-dichlorobenzoyl)-4-(1-phenylethenyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | 12-(3,4-dichlorobenzoyl)-4-(1-phenylethenyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155366527 |
| Molecular Formula | C24H20Cl2N4O2 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 12-(3,4-dichlorobenzoyl)-4-(1-phenylethenyl)-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C=C(c1ccccc1)N1CCn2nc3c(c2C1=O)CN(C(=O)c1ccc(Cl)c(Cl)c1)CC3 |
| InChI | InChI=1S/C24H20Cl2N4O2/c1-15(16-5-3-2-4-6-16)29-11-12-30-22(24(29)32)18-14-28(10-9-21(18)27-30)23(31)17-7-8-19(25)20(26)13-17/h2-8,13H,1,9-12,14H2 |
| InChIKey | IIVRQTCMPKRGCE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |