C18H15Cl2N5O — CID 155343476
(3,4-dichlorophenyl)-(3,4,9,10,14-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(16),2(6),4,10-tetraen-14-yl)methanone (PubChem CID 155343476) has the molecular formula C18H15Cl2N5O and a molecular weight of 388.26 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(3,4,9,10,14-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(16),2(6),4,10-tetraen-14-yl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(3,4,9,10,14-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(16),2(6),4,10-tetraen-14-yl)methanone |
|---|---|
| PubChem CID | 155343476 |
| Molecular Formula | C18H15Cl2N5O |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (3,4-dichlorophenyl)-(3,4,9,10,14-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(16),2(6),4,10-tetraen-14-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCc2nn3c(c2C1)-c1[nH]ncc1CC3 |
| InChI | InChI=1S/C18H15Cl2N5O/c19-13-2-1-10(7-14(13)20)18(26)24-5-4-15-12(9-24)17-16-11(8-21-22-16)3-6-25(17)23-15/h1-2,7-8H,3-6,9H2,(H,21,22) |
| InChIKey | RREWKQFZPCALKT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |