C17H15Cl2IN4O — CID 155350238
5-(3,4-dichlorobenzoyl)-2-(3-iodopropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carbonitrile (PubChem CID 155350238) has the molecular formula C17H15Cl2IN4O and a molecular weight of 489.14 g/mol. Its IUPAC name is 5-(3,4-dichlorobenzoyl)-2-(3-iodopropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carbonitrile.
| Compound Name | 5-(3,4-dichlorobenzoyl)-2-(3-iodopropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 155350238 |
| Molecular Formula | C17H15Cl2IN4O |
| Molecular Weight | 489.14 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 5-(3,4-dichlorobenzoyl)-2-(3-iodopropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carbonitrile |
| SMILES | N#Cc1c2c(nn1CCCI)CCN(C(=O)c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C17H15Cl2IN4O/c18-13-3-2-11(8-14(13)19)17(25)23-7-4-15-12(10-23)16(9-21)24(22-15)6-1-5-20/h2-3,8H,1,4-7,10H2 |
| InChIKey | WZANDFIREDCHFL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.14 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|