C24H22Cl2FN5O2 — CID 155366458
(11R)-12-(3,4-dichlorobenzoyl)-4-[(6-fluoro-4-methyl-3-pyridinyl)methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155366458) has the molecular formula C24H22Cl2FN5O2 and a molecular weight of 502.38 g/mol. Its IUPAC name is (11R)-12-(3,4-dichlorobenzoyl)-4-[(6-fluoro-4-methyl-3-pyridinyl)methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-12-(3,4-dichlorobenzoyl)-4-[(6-fluoro-4-methyl-3-pyridinyl)methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155366458 |
| Molecular Formula | C24H22Cl2FN5O2 |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | (11R)-12-(3,4-dichlorobenzoyl)-4-[(6-fluoro-4-methyl-3-pyridinyl)methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | Cc1cc(F)ncc1CN1CCn2nc3c(c2C1=O)CN(C(=O)c1ccc(Cl)c(Cl)c1)[C@H](C)C3 |
| InChI | InChI=1S/C24H22Cl2FN5O2/c1-13-7-21(27)28-10-16(13)11-30-5-6-32-22(24(30)34)17-12-31(14(2)8-20(17)29-32)23(33)15-3-4-18(25)19(26)9-15/h3-4,7,9-10,14H,5-6,8,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | OGVMZRYGLUIGRS-CQSZACIVSA-N |
| XLogP | 4.28 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|