C20H20Cl2N8O2 — CID 155366747
(11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[(2-methyltetrazol-5-yl)methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155366747) has the molecular formula C20H20Cl2N8O2 and a molecular weight of 475.34 g/mol. Its IUPAC name is (11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[(2-methyltetrazol-5-yl)methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[(2-methyltetrazol-5-yl)methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155366747 |
| Molecular Formula | C20H20Cl2N8O2 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | (11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[(2-methyltetrazol-5-yl)methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(=O)N(Cc1nnn(C)n1)CC3 |
| InChI | InChI=1S/C20H20Cl2N8O2/c1-11-7-16-13(9-29(11)19(31)12-3-4-14(21)15(22)8-12)18-20(32)28(5-6-30(18)24-16)10-17-23-26-27(2)25-17/h3-4,8,11H,5-7,9-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | OWJFFGOHBVRPSR-LLVKDONJSA-N |
| XLogP | 1.96 |
| TPSA | 102.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |