C22H18Cl2F3N5O3 — CID 155731708
(11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[[2-(trifluoromethyl)-1,3-oxazol-4-yl]methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155731708) has the molecular formula C22H18Cl2F3N5O3 and a molecular weight of 528.32 g/mol. Its IUPAC name is (11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[[2-(trifluoromethyl)-1,3-oxazol-4-yl]methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[[2-(trifluoromethyl)-1,3-oxazol-4-yl]methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155731708 |
| Molecular Formula | C22H18Cl2F3N5O3 |
| Molecular Weight | 528.32 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | (11R)-12-(3,4-dichlorobenzoyl)-11-methyl-4-[[2-(trifluoromethyl)-1,3-oxazol-4-yl]methyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(=O)N(Cc1coc(C(F)(F)F)n1)CC3 |
| InChI | InChI=1S/C22H18Cl2F3N5O3/c1-11-6-17-14(9-31(11)19(33)12-2-3-15(23)16(24)7-12)18-20(34)30(4-5-32(18)29-17)8-13-10-35-21(28-13)22(25,26)27/h2-3,7,10-11H,4-6,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | APKKILAHJWGBMJ-LLVKDONJSA-N |
| XLogP | 4.44 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |