C23H22Cl3N5O2 — CID 155731800
[(11R)-4-[(6-chloro-3-pyridinyl)methyl]-3-hydroxy-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]-(3,4-dichlorophenyl)methanone (PubChem CID 155731800) has the molecular formula C23H22Cl3N5O2 and a molecular weight of 506.82 g/mol. Its IUPAC name is [(11R)-4-[(6-chloro-3-pyridinyl)methyl]-3-hydroxy-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]-(3,4-dichlorophenyl)methanone.
| Compound Name | [(11R)-4-[(6-chloro-3-pyridinyl)methyl]-3-hydroxy-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 155731800 |
| Molecular Formula | C23H22Cl3N5O2 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | [(11R)-4-[(6-chloro-3-pyridinyl)methyl]-3-hydroxy-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]-(3,4-dichlorophenyl)methanone |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(O)N(Cc1ccc(Cl)nc1)CC3 |
| InChI | InChI=1S/C23H22Cl3N5O2/c1-13-8-19-16(12-30(13)22(32)15-3-4-17(24)18(25)9-15)21-23(33)29(6-7-31(21)28-19)11-14-2-5-20(26)27-10-14/h2-5,9-10,13,23,33H,6-8,11-12H2,1H3/t13-,23?/m1/s1 |
| InChIKey | NBCNSQVKJNOFAG-JHQYKTOJSA-N |
| XLogP | 4.33 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|