C26H26Cl2F2N4O3 — CID 167098554
(3,4-dichlorophenyl)-[(5S,11R)-4-[[4-(difluoromethoxy)phenyl]methyl]-3-hydroxy-5,11-dimethyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]methanone (PubChem CID 167098554) has the molecular formula C26H26Cl2F2N4O3 and a molecular weight of 551.42 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[(5S,11R)-4-[[4-(difluoromethoxy)phenyl]methyl]-3-hydroxy-5,11-dimethyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[(5S,11R)-4-[[4-(difluoromethoxy)phenyl]methyl]-3-hydroxy-5,11-dimethyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]methanone |
|---|---|
| PubChem CID | 167098554 |
| Molecular Formula | C26H26Cl2F2N4O3 |
| Molecular Weight | 551.42 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | (3,4-dichlorophenyl)-[(5S,11R)-4-[[4-(difluoromethoxy)phenyl]methyl]-3-hydroxy-5,11-dimethyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]methanone |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(O)N(Cc1ccc(OC(F)F)cc1)[C@@H](C)C3 |
| InChI | InChI=1S/C26H26Cl2F2N4O3/c1-14-9-22-19(13-33(14)24(35)17-5-8-20(27)21(28)10-17)23-25(36)32(15(2)11-34(23)31-22)12-16-3-6-18(7-4-16)37-26(29)30/h3-8,10,14-15,25-26,36H,9,11-13H2,1-2H3/t14-,15+,25?/m1/s1 |
| InChIKey | XZWZRLZXTPKTOS-SVLBOIQBSA-N |
| XLogP | 5.27 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |