C23H25F4N5O3 — CID 145435109
N-[4-fluoro-3-(trifluoromethyl)phenyl]-11-(1-hydroxyprop-2-enyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 145435109) has the molecular formula C23H25F4N5O3 and a molecular weight of 495.48 g/mol. Its IUPAC name is N-[4-fluoro-3-(trifluoromethyl)phenyl]-11-(1-hydroxyprop-2-enyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-11-(1-hydroxyprop-2-enyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 145435109 |
| Molecular Formula | C23H25F4N5O3 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-11-(1-hydroxyprop-2-enyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C=CC(O)C1CN(C)C(=O)c2c3c(nn2C1)CC(C)N(C(=O)Nc1ccc(F)c(C(F)(F)F)c1)C3 |
| InChI | InChI=1S/C23H25F4N5O3/c1-4-19(33)13-9-30(3)21(34)20-15-11-31(12(2)7-18(15)29-32(20)10-13)22(35)28-14-5-6-17(24)16(8-14)23(25,26)27/h4-6,8,12-13,19,33H,1,7,9-11H2,2-3H3,(H,28,35) |
| InChIKey | OLHZFXOYAFBIGN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|