C20H24F4N6O2 — CID 156516472
11-(aminomethyl)-4-[[4-fluoro-3-(trifluoromethyl)anilino]-hydroxymethyl]-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one (PubChem CID 156516472) has the molecular formula C20H24F4N6O2 and a molecular weight of 456.44 g/mol. Its IUPAC name is 11-(aminomethyl)-4-[[4-fluoro-3-(trifluoromethyl)anilino]-hydroxymethyl]-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one.
| Compound Name | 11-(aminomethyl)-4-[[4-fluoro-3-(trifluoromethyl)anilino]-hydroxymethyl]-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one |
|---|---|
| PubChem CID | 156516472 |
| Molecular Formula | C20H24F4N6O2 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 11-(aminomethyl)-4-[[4-fluoro-3-(trifluoromethyl)anilino]-hydroxymethyl]-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one |
| SMILES | CN1CC(CN)Cn2nc3c(c2C1=O)CN(C(O)Nc1ccc(F)c(C(F)(F)F)c1)CC3 |
| InChI | InChI=1S/C20H24F4N6O2/c1-28-8-11(7-25)9-30-17(18(28)31)13-10-29(5-4-16(13)27-30)19(32)26-12-2-3-15(21)14(6-12)20(22,23)24/h2-3,6,11,19,26,32H,4-5,7-10,25H2,1H3 |
| InChIKey | SWJRZFGOOWNOMD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|