C25H23FN6O3 — CID 164809953
N-(4-fluoro-3-isocyanophenyl)-11-hydroxy-13-methyl-14-oxo-11-phenyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 164809953) has the molecular formula C25H23FN6O3 and a molecular weight of 474.50 g/mol. Its IUPAC name is N-(4-fluoro-3-isocyanophenyl)-11-hydroxy-13-methyl-14-oxo-11-phenyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | N-(4-fluoro-3-isocyanophenyl)-11-hydroxy-13-methyl-14-oxo-11-phenyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 164809953 |
| Molecular Formula | C25H23FN6O3 |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-(4-fluoro-3-isocyanophenyl)-11-hydroxy-13-methyl-14-oxo-11-phenyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)N2CCc3nn4c(c3C2)C(=O)N(C)CC(O)(c2ccccc2)C4)ccc1F |
| InChI | InChI=1S/C25H23FN6O3/c1-27-21-12-17(8-9-19(21)26)28-24(34)31-11-10-20-18(13-31)22-23(33)30(2)14-25(35,15-32(22)29-20)16-6-4-3-5-7-16/h3-9,12,35H,10-11,13-15H2,2H3,(H,28,34) |
| InChIKey | BTFAHUNOASIJRF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|