C12H12F5N3S — CID 142577289
(5S,7S)-7-fluoro-5-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-2-(trifluoromethylsulfanyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 142577289) has the molecular formula C12H12F5N3S and a molecular weight of 325.31 g/mol. Its IUPAC name is (5S,7S)-7-fluoro-5-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-2-(trifluoromethylsulfanyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-7-fluoro-5-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-2-(trifluoromethylsulfanyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 142577289 |
| Molecular Formula | C12H12F5N3S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (5S,7S)-7-fluoro-5-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-2-(trifluoromethylsulfanyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C/C=C(\C=C(/C)F)[C@@H]1C[C@H](F)c2nc(SC(F)(F)F)nn21 |
| InChI | InChI=1S/C12H12F5N3S/c1-3-7(4-6(2)13)9-5-8(14)10-18-11(19-20(9)10)21-12(15,16)17/h3-4,8-9H,5H2,1-2H3/b6-4+,7-3+/t8-,9-/m0/s1 |
| InChIKey | WFKNNANWPXNIQZ-SJQOPHGFSA-N |
| XLogP | 4.66 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|