C13H13F4N3OS — CID 142577257
5-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-4-yl]-7-fluoro-2-(fluoromethylsulfinyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 142577257) has the molecular formula C13H13F4N3OS and a molecular weight of 335.33 g/mol. Its IUPAC name is 5-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-4-yl]-7-fluoro-2-(fluoromethylsulfinyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | 5-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-4-yl]-7-fluoro-2-(fluoromethylsulfinyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 142577257 |
| Molecular Formula | C13H13F4N3OS |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 5-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-4-yl]-7-fluoro-2-(fluoromethylsulfinyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C=C/C=C(C(\F)=C(/C)F)/C1CC(F)c2nc(S(=O)CF)nn21 |
| InChI | InChI=1S/C13H13F4N3OS/c1-3-4-8(11(17)7(2)15)10-5-9(16)12-18-13(19-20(10)12)22(21)6-14/h3-4,9-10H,1,5-6H2,2H3/b8-4-,11-7- |
| InChIKey | WNSCKOVOXIOYDK-DAOKFOGXSA-N |
| XLogP | 3.55 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|