C12H12ClF2N3OS — CID 142577277
(5S,7S)-5-(2-chlorocyclohexa-2,4-dien-1-yl)-7-fluoro-2-[(R)-fluoromethylsulfinyl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 142577277) has the molecular formula C12H12ClF2N3OS and a molecular weight of 319.76 g/mol. Its IUPAC name is (5S,7S)-5-(2-chlorocyclohexa-2,4-dien-1-yl)-7-fluoro-2-[(R)-fluoromethylsulfinyl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-5-(2-chlorocyclohexa-2,4-dien-1-yl)-7-fluoro-2-[(R)-fluoromethylsulfinyl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 142577277 |
| Molecular Formula | C12H12ClF2N3OS |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | (5S,7S)-5-(2-chlorocyclohexa-2,4-dien-1-yl)-7-fluoro-2-[(R)-fluoromethylsulfinyl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | O=[S@@](CF)c1nc2n(n1)[C@H](C1CC=CC=C1Cl)C[C@@H]2F |
| InChI | InChI=1S/C12H12ClF2N3OS/c13-8-4-2-1-3-7(8)10-5-9(15)11-16-12(17-18(10)11)20(19)6-14/h1-2,4,7,9-10H,3,5-6H2/t7?,9-,10-,20-/m0/s1 |
| InChIKey | RTKFLMOSYOAHII-HHNPFVMASA-N |
| XLogP | 2.97 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |