C13H18F3N3OS — CID 142577360
(5S,7S)-2-(2,2-difluoroethylsulfinyl)-7-fluoro-5-[(Z)-hex-4-en-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 142577360) has the molecular formula C13H18F3N3OS and a molecular weight of 321.37 g/mol. Its IUPAC name is (5S,7S)-2-(2,2-difluoroethylsulfinyl)-7-fluoro-5-[(Z)-hex-4-en-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-2-(2,2-difluoroethylsulfinyl)-7-fluoro-5-[(Z)-hex-4-en-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 142577360 |
| Molecular Formula | C13H18F3N3OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (5S,7S)-2-(2,2-difluoroethylsulfinyl)-7-fluoro-5-[(Z)-hex-4-en-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C/C=C\C(CC)[C@@H]1C[C@H](F)c2nc(S(=O)CC(F)F)nn21 |
| InChI | InChI=1S/C13H18F3N3OS/c1-3-5-8(4-2)10-6-9(14)12-17-13(18-19(10)12)21(20)7-11(15)16/h3,5,8-11H,4,6-7H2,1-2H3/b5-3-/t8?,9-,10-,21?/m0/s1 |
| InChIKey | DLVNQUIOKOPHEU-KFEKQFOFSA-N |
| XLogP | 3.21 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|