C20H17F3N2O3 — CID 142578444
6-N-[4-propyl-3-(trifluoromethyl)phenyl]-1-benzofuran-2,6-dicarboxamide (PubChem CID 142578444) has the molecular formula C20H17F3N2O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is 6-N-[4-propyl-3-(trifluoromethyl)phenyl]-1-benzofuran-2,6-dicarboxamide.
| Compound Name | 6-N-[4-propyl-3-(trifluoromethyl)phenyl]-1-benzofuran-2,6-dicarboxamide |
|---|---|
| PubChem CID | 142578444 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 6-N-[4-propyl-3-(trifluoromethyl)phenyl]-1-benzofuran-2,6-dicarboxamide |
| SMILES | CCCc1ccc(NC(=O)c2ccc3cc(C(N)=O)oc3c2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H17F3N2O3/c1-2-3-11-6-7-14(10-15(11)20(21,22)23)25-19(27)13-5-4-12-8-17(18(24)26)28-16(12)9-13/h4-10H,2-3H2,1H3,(H2,24,26)(H,25,27) |
| InChIKey | XDPIWFVZFPNWAJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |