C16H19F3N4O2S — CID 142582752
N-[[1-[7-(trifluoromethyl)quinazolin-4-yl]piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 142582752) has the molecular formula C16H19F3N4O2S and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[[1-[7-(trifluoromethyl)quinazolin-4-yl]piperidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-[7-(trifluoromethyl)quinazolin-4-yl]piperidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 142582752 |
| Molecular Formula | C16H19F3N4O2S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[[1-[7-(trifluoromethyl)quinazolin-4-yl]piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC1CCCN(c2ncnc3cc(C(F)(F)F)ccc23)C1 |
| InChI | InChI=1S/C16H19F3N4O2S/c1-26(24,25)22-8-11-3-2-6-23(9-11)15-13-5-4-12(16(17,18)19)7-14(13)20-10-21-15/h4-5,7,10-11,22H,2-3,6,8-9H2,1H3 |
| InChIKey | QTUWBAOWUHJUHM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |