C15H15BrF4N4S — CID 142582760
1-[1-(7-bromo-6-fluoroquinazolin-4-yl)piperidin-3-yl]-N-(trifluoromethylsulfanyl)methanamine (PubChem CID 142582760) has the molecular formula C15H15BrF4N4S and a molecular weight of 439.28 g/mol. Its IUPAC name is 1-[1-(7-bromo-6-fluoroquinazolin-4-yl)piperidin-3-yl]-N-(trifluoromethylsulfanyl)methanamine.
| Compound Name | 1-[1-(7-bromo-6-fluoroquinazolin-4-yl)piperidin-3-yl]-N-(trifluoromethylsulfanyl)methanamine |
|---|---|
| PubChem CID | 142582760 |
| Molecular Formula | C15H15BrF4N4S |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 1-[1-(7-bromo-6-fluoroquinazolin-4-yl)piperidin-3-yl]-N-(trifluoromethylsulfanyl)methanamine |
| SMILES | Fc1cc2c(N3CCCC(CNSC(F)(F)F)C3)ncnc2cc1Br |
| InChI | InChI=1S/C15H15BrF4N4S/c16-11-5-13-10(4-12(11)17)14(22-8-21-13)24-3-1-2-9(7-24)6-23-25-15(18,19)20/h4-5,8-9,23H,1-3,6-7H2 |
| InChIKey | SBLGQNZNKUWOJI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|