C25H29N7OS — CID 142583064
N,N'-diamino-N-benzyl-2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-2-thiophen-3-ylethanimidamide (PubChem CID 142583064) has the molecular formula C25H29N7OS and a molecular weight of 475.62 g/mol. Its IUPAC name is N,N'-diamino-N-benzyl-2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-2-thiophen-3-ylethanimidamide.
| Compound Name | N,N'-diamino-N-benzyl-2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-2-thiophen-3-ylethanimidamide |
|---|---|
| PubChem CID | 142583064 |
| Molecular Formula | C25H29N7OS |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N,N'-diamino-N-benzyl-2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-2-thiophen-3-ylethanimidamide |
| SMILES | N/N=C(/C(c1ccsc1)N1CCC(n2c(=O)[nH]c3ccccc32)CC1)N(N)Cc1ccccc1 |
| InChI | InChI=1S/C25H29N7OS/c26-29-24(31(27)16-18-6-2-1-3-7-18)23(19-12-15-34-17-19)30-13-10-20(11-14-30)32-22-9-5-4-8-21(22)28-25(32)33/h1-9,12,15,17,20,23H,10-11,13-14,16,26-27H2,(H,28,33)/b29-24- |
| InChIKey | QJYDGJQODYYQLW-OLFWJLLRSA-N |
| XLogP | 3.42 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|