C28H33ClN4O3S — CID 67177436
3-[benzyl(thiophen-2-ylmethyl)amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate;hydrochloride (PubChem CID 67177436) has the molecular formula C28H33ClN4O3S and a molecular weight of 541.12 g/mol. Its IUPAC name is 3-[benzyl(thiophen-2-ylmethyl)amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate;hydrochloride.
| Compound Name | 3-[benzyl(thiophen-2-ylmethyl)amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67177436 |
| Molecular Formula | C28H33ClN4O3S |
| Molecular Weight | 541.12 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 3-[benzyl(thiophen-2-ylmethyl)amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCCCN(Cc1ccccc1)Cc1cccs1)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C28H32N4O3S.ClH/c33-27-29-25-11-4-5-12-26(25)32(27)23-13-16-31(17-14-23)28(34)35-18-7-15-30(21-24-10-6-19-36-24)20-22-8-2-1-3-9-22;/h1-6,8-12,19,23H,7,13-18,20-21H2,(H,29,33);1H |
| InChIKey | MZGUVKDLKHVKBK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.12 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|