C30H36N4O3 — CID 71043665
3-[benzyl(cyclohexa-2,4-dien-1-ylmethyl)amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate (PubChem CID 71043665) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is 3-[benzyl(cyclohexa-2,4-dien-1-ylmethyl)amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate.
| Compound Name | 3-[benzyl(cyclohexa-2,4-dien-1-ylmethyl)amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71043665 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 3-[benzyl(cyclohexa-2,4-dien-1-ylmethyl)amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCCCN(Cc1ccccc1)CC1C=CC=CC1)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C30H36N4O3/c35-29-31-27-14-7-8-15-28(27)34(29)26-16-19-33(20-17-26)30(36)37-21-9-18-32(22-24-10-3-1-4-11-24)23-25-12-5-2-6-13-25/h1-8,10-12,14-15,25-26H,9,13,16-23H2,(H,31,35) |
| InChIKey | LCPQJXYGENHWAA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|