C37H40N4O4 — CID 67178096
3-[benzyl-[(3-phenylmethoxyphenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate (PubChem CID 67178096) has the molecular formula C37H40N4O4 and a molecular weight of 604.75 g/mol. Its IUPAC name is 3-[benzyl-[(3-phenylmethoxyphenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate.
| Compound Name | 3-[benzyl-[(3-phenylmethoxyphenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67178096 |
| Molecular Formula | C37H40N4O4 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 3-[benzyl-[(3-phenylmethoxyphenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCCCN(Cc1ccccc1)Cc1cccc(OCc2ccccc2)c1)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C37H40N4O4/c42-36-38-34-17-7-8-18-35(34)41(36)32-19-22-40(23-20-32)37(43)44-24-10-21-39(26-29-11-3-1-4-12-29)27-31-15-9-16-33(25-31)45-28-30-13-5-2-6-14-30/h1-9,11-18,25,32H,10,19-24,26-28H2,(H,38,42) |
| InChIKey | IELLKEVGHISVJT-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|