C30H33ClN4O3 — CID 67177534
3-[benzyl-[(4-chlorophenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate (PubChem CID 67177534) has the molecular formula C30H33ClN4O3 and a molecular weight of 533.07 g/mol. Its IUPAC name is 3-[benzyl-[(4-chlorophenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate.
| Compound Name | 3-[benzyl-[(4-chlorophenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67177534 |
| Molecular Formula | C30H33ClN4O3 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 3-[benzyl-[(4-chlorophenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCCCN(Cc1ccccc1)Cc1ccc(Cl)cc1)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C30H33ClN4O3/c31-25-13-11-24(12-14-25)22-33(21-23-7-2-1-3-8-23)17-6-20-38-30(37)34-18-15-26(16-19-34)35-28-10-5-4-9-27(28)32-29(35)36/h1-5,7-14,26H,6,15-22H2,(H,32,36) |
| InChIKey | WLODWFYKWLOZMA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|