C21H20O — CID 142583234
4-[4-(4-methylnaphthalen-1-yl)phenyl]but-1-en-2-ol (PubChem CID 142583234) has the molecular formula C21H20O and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-[4-(4-methylnaphthalen-1-yl)phenyl]but-1-en-2-ol.
| Compound Name | 4-[4-(4-methylnaphthalen-1-yl)phenyl]but-1-en-2-ol |
|---|---|
| PubChem CID | 142583234 |
| Molecular Formula | C21H20O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-[4-(4-methylnaphthalen-1-yl)phenyl]but-1-en-2-ol |
| SMILES | C=C(O)CCc1ccc(-c2ccc(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C21H20O/c1-15-7-14-20(21-6-4-3-5-19(15)21)18-12-10-17(11-13-18)9-8-16(2)22/h3-7,10-14,22H,2,8-9H2,1H3 |
| InChIKey | QYXYDZXZEVJNDZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|