C25H21NO2 — CID 135320437
N-hydroxy-2-[4-(4-methylnaphthalen-1-yl)phenyl]-2-phenylacetamide (PubChem CID 135320437) has the molecular formula C25H21NO2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-hydroxy-2-[4-(4-methylnaphthalen-1-yl)phenyl]-2-phenylacetamide.
| Compound Name | N-hydroxy-2-[4-(4-methylnaphthalen-1-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 135320437 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-hydroxy-2-[4-(4-methylnaphthalen-1-yl)phenyl]-2-phenylacetamide |
| SMILES | Cc1ccc(-c2ccc(C(C(=O)NO)c3ccccc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H21NO2/c1-17-11-16-22(23-10-6-5-9-21(17)23)18-12-14-20(15-13-18)24(25(27)26-28)19-7-3-2-4-8-19/h2-16,24,28H,1H3,(H,26,27) |
| InChIKey | UXCANXJXOYWVII-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|