C24H22N2O3 — CID 135320146
N-cyclopropyl-4-[4-[2-(hydroxyamino)-2-oxo-1-phenylethyl]phenyl]benzamide (PubChem CID 135320146) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-cyclopropyl-4-[4-[2-(hydroxyamino)-2-oxo-1-phenylethyl]phenyl]benzamide.
| Compound Name | N-cyclopropyl-4-[4-[2-(hydroxyamino)-2-oxo-1-phenylethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 135320146 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-cyclopropyl-4-[4-[2-(hydroxyamino)-2-oxo-1-phenylethyl]phenyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(-c2ccc(C(C(=O)NO)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O3/c27-23(25-21-14-15-21)20-12-8-17(9-13-20)16-6-10-19(11-7-16)22(24(28)26-29)18-4-2-1-3-5-18/h1-13,21-22,29H,14-15H2,(H,25,27)(H,26,28) |
| InChIKey | MTFCWANPFSVSGV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|