C22H20N2O3 — CID 135320610
2-(2-acetamidophenyl)-N-hydroxy-2-phenylacetamide;bicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 135320610) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-(2-acetamidophenyl)-N-hydroxy-2-phenylacetamide;bicyclo[2.2.0]hexa-1,3,5-triene.
| Compound Name | 2-(2-acetamidophenyl)-N-hydroxy-2-phenylacetamide;bicyclo[2.2.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 135320610 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-(2-acetamidophenyl)-N-hydroxy-2-phenylacetamide;bicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | CC(=O)Nc1ccccc1C(C(=O)NO)c1ccccc1.c1cc2ccc1-2 |
| InChI | InChI=1S/C16H16N2O3.C6H4/c1-11(19)17-14-10-6-5-9-13(14)15(16(20)18-21)12-7-3-2-4-8-12;1-2-6-4-3-5(1)6/h2-10,15,21H,1H3,(H,17,19)(H,18,20);1-4H |
| InChIKey | YEHYRGZKUGRYAN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|