C28H33N5O5 — CID 162756937
3-[[2-[[2-amino-5-(carbamoylamino)pentanoyl]amino]acetyl]amino]-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid (PubChem CID 162756937) has the molecular formula C28H33N5O5 and a molecular weight of 519.60 g/mol. Its IUPAC name is 3-[[2-[[2-amino-5-(carbamoylamino)pentanoyl]amino]acetyl]amino]-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid.
| Compound Name | 3-[[2-[[2-amino-5-(carbamoylamino)pentanoyl]amino]acetyl]amino]-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 162756937 |
| Molecular Formula | C28H33N5O5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 3-[[2-[[2-amino-5-(carbamoylamino)pentanoyl]amino]acetyl]amino]-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid |
| SMILES | Cc1ccc(-c2ccc(C(CC(=O)O)NC(=O)CNC(=O)C(N)CCCNC(N)=O)cc2)c2ccccc12 |
| InChI | InChI=1S/C28H33N5O5/c1-17-8-13-21(22-6-3-2-5-20(17)22)18-9-11-19(12-10-18)24(15-26(35)36)33-25(34)16-32-27(37)23(29)7-4-14-31-28(30)38/h2-3,5-6,8-13,23-24H,4,7,14-16,29H2,1H3,(H,32,37)(H,33,34)(H,35,36)(H3,30,31,38) |
| InChIKey | IPWJKRSQKLEBKI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|