C28H34N6O5 — CID 171529119
(3S)-3-[[2-[[2-amino-5-(carbamoylamino)pentanoyl]amino]acetyl]amino]-3-[4-[4-(methylamino)naphthalen-1-yl]phenyl]propanoic acid (PubChem CID 171529119) has the molecular formula C28H34N6O5 and a molecular weight of 534.62 g/mol. Its IUPAC name is (3S)-3-[[2-[[2-amino-5-(carbamoylamino)pentanoyl]amino]acetyl]amino]-3-[4-[4-(methylamino)naphthalen-1-yl]phenyl]propanoic acid.
| Compound Name | (3S)-3-[[2-[[2-amino-5-(carbamoylamino)pentanoyl]amino]acetyl]amino]-3-[4-[4-(methylamino)naphthalen-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 171529119 |
| Molecular Formula | C28H34N6O5 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | (3S)-3-[[2-[[2-amino-5-(carbamoylamino)pentanoyl]amino]acetyl]amino]-3-[4-[4-(methylamino)naphthalen-1-yl]phenyl]propanoic acid |
| SMILES | CNc1ccc(-c2ccc([C@H](CC(=O)O)NC(=O)CNC(=O)C(N)CCCNC(N)=O)cc2)c2ccccc12 |
| InChI | InChI=1S/C28H34N6O5/c1-31-23-13-12-19(20-5-2-3-6-21(20)23)17-8-10-18(11-9-17)24(15-26(36)37)34-25(35)16-33-27(38)22(29)7-4-14-32-28(30)39/h2-3,5-6,8-13,22,24,31H,4,7,14-16,29H2,1H3,(H,33,38)(H,34,35)(H,36,37)(H3,30,32,39)/t22?,24-/m0/s1 |
| InChIKey | SHWRJJYNEPOFEV-GITCGBDTSA-N |
| XLogP | 2.07 |
| TPSA | 188.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|