C27H36N4O5 — CID 10141550
3-[[2-[5-(butylcarbamoylamino)pentanoylamino]acetyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 10141550) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is 3-[[2-[5-(butylcarbamoylamino)pentanoylamino]acetyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-[[2-[5-(butylcarbamoylamino)pentanoylamino]acetyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 10141550 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 3-[[2-[5-(butylcarbamoylamino)pentanoylamino]acetyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CCCCNC(=O)NCCCCC(=O)NCC(=O)NC(CC(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H36N4O5/c1-2-3-16-28-27(36)29-17-8-7-11-24(32)30-19-25(33)31-23(18-26(34)35)22-14-12-21(13-15-22)20-9-5-4-6-10-20/h4-6,9-10,12-15,23H,2-3,7-8,11,16-19H2,1H3,(H,30,32)(H,31,33)(H,34,35)(H2,28,29,36) |
| InChIKey | MOBDZILYQSHWPB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|