C31H31F3N4O7 — CID 142177998
(2,2,2-trifluoroacetyl) 3-[[2-[4-(benzylcarbamoylamino)butanoylamino]acetyl]amino]-3-(4-phenylphenyl)propaneperoxoate (PubChem CID 142177998) has the molecular formula C31H31F3N4O7 and a molecular weight of 628.60 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[[2-[4-(benzylcarbamoylamino)butanoylamino]acetyl]amino]-3-(4-phenylphenyl)propaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[[2-[4-(benzylcarbamoylamino)butanoylamino]acetyl]amino]-3-(4-phenylphenyl)propaneperoxoate |
|---|---|
| PubChem CID | 142177998 |
| Molecular Formula | C31H31F3N4O7 |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[[2-[4-(benzylcarbamoylamino)butanoylamino]acetyl]amino]-3-(4-phenylphenyl)propaneperoxoate |
| SMILES | O=C(CCCNC(=O)NCc1ccccc1)NCC(=O)NC(CC(=O)OOC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H31F3N4O7/c32-31(33,34)29(42)45-44-28(41)18-25(24-15-13-23(14-16-24)22-10-5-2-6-11-22)38-27(40)20-36-26(39)12-7-17-35-30(43)37-19-21-8-3-1-4-9-21/h1-6,8-11,13-16,25H,7,12,17-20H2,(H,36,39)(H,38,40)(H2,35,37,43) |
| InChIKey | LBLUEEUGNYYIHF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|