C14H17FN2O5S — CID 142585327
4-[[2-(2-methylpropanoylamino)-3-oxopropyl]carbamoyl]benzenesulfonyl fluoride (PubChem CID 142585327) has the molecular formula C14H17FN2O5S and a molecular weight of 344.36 g/mol. Its IUPAC name is 4-[[2-(2-methylpropanoylamino)-3-oxopropyl]carbamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[[2-(2-methylpropanoylamino)-3-oxopropyl]carbamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 142585327 |
| Molecular Formula | C14H17FN2O5S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-[[2-(2-methylpropanoylamino)-3-oxopropyl]carbamoyl]benzenesulfonyl fluoride |
| SMILES | CC(C)C(=O)NC(C=O)CNC(=O)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C14H17FN2O5S/c1-9(2)13(19)17-11(8-18)7-16-14(20)10-3-5-12(6-4-10)23(15,21)22/h3-6,8-9,11H,7H2,1-2H3,(H,16,20)(H,17,19) |
| InChIKey | WJFKHUGPQHBETG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|